Serotonin D4 Hydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-16253 |
| Alternative Name(s) | 3-[2-amino(1,1,2,2-D4)ethyl]-1H-indol-5-ol hydrochloride; 5-Hydroxytryptamine-d4 Hydrochloride; Hippophaine-d4 Hydrochloride;CS-CX-00547 |
| Research Area | Labeled Serotonin, intended for use as an internal standard for the quantification of Serotonin by GC- or LC-mass spectrometry. |
| Molecular Formula | C10H9D4ClN2O |
| CAS# | 58264-95-2 (Free base) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NC([2H])([2H])C([2H])([2H])C1=CNC2=C1C=C(O)C=C2.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO16253.html |
| Additional Information | NULL |