Montelukast Acid
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-01846 |
| Alternative Name(s) | (R-(E))-1-(((1-(3-(2-(7-Chloro-2-quinolinyl)ethenyl)phenyl)-3-(2-(1-hydroxy-1-methylethyl)phenyl)propyl)thio)methyl)cyclopropaneacetic acid ;2-[1-[[(1R)-1-[3-[(E)-2-(7-Chloroquinolin-2-yl)ethenyl]phenyl]-3-[2-(2-hydroxypropan-2-yl)phenyl]propyl]sulfanylmethyl]cyclopropyl]acetic acid ; |
| Research Area | Montelukast is an orally available leukotriene receptor antagonist which is widely used for the prophylaxis and chronic treatment of asthma |
| Molecular Formula | C35H36ClNO3S |
| CAS# | 158966-92-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(CC1(CC1)CS[C@@H](C2=CC(/C=C/C3=NC4=CC(Cl)=CC=C4C=C3)=CC=C2)CCC(C=CC=C5)=C5C(C)(O)C)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01846.html |
| Additional Information | NULL |