Danofloxacin D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-16166 |
| Alternative Name(s) | 1-cyclopropyl-6-fluoro-7-[(1S,4S)-5-(D3)methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
| Research Area | Labeled Danofloxacin, intended for use as an internal standard for the quantification of Danofloxacin by GC- or LC-mass spectrometry. |
| Molecular Formula | C19H17D3FN3O3 |
| CAS# | 1825377-28-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1C2=CC(F)=C(N3[C@H](CN4C([2H])([2H])[2H])C[C@H]4C3)C=C2N(C5CC5)C=C1C(O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO16166.html |
| Additional Information | NULL |