cis-4,7,10,13,16,19-Docosahexaenoic Acid Methyl Ester
Fatty Acid Derivatives
| Trivial name | NULL |
| Catalog Number | CS-O-01400 |
| Alternative Name(s) | Methyl 4,7,10,13,1,19-docosahexaenoate; Methyl cis,cis,cis,cis,cis,cis-docosa-4,7,10,13,16,19-hexaenoate; Methyl cis-4,7,10,13,16,19-docosahexaenoate; Methyl Docosahexaenoate; |
| Research Area | A type of biodiesel with industrial applications. Used as a reagent in cholesterol photooxidation. Impurity in commercial preparations of Docosahexaenoic Acid. |
| Molecular Formula | C23H34O2 |
| CAS# | 2566-90-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(OC)CC/C=CC/C=CC/C=CC/C=CC/C=CC/C=CCC |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01400.html |
| Additional Information | NULL |