Cyclobenzaprine D3 Hydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02918 |
| Alternative Name(s) | 3-(5H-Dibenzo[ahyl-N-(methyl-d3)-1-propanamine Hyil-d3; Flexiban-d3; |
| Research Area | Labeled Cyclobenzaprine, intended for use as an internal standard for the quantification of Cyclobenzaprine by GC- or LC-mass spectrometry. |
| Molecular Formula | C20H19DClN |
| CAS# | 1184983-42-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CN(C([2H])([2H])[2H])CC/C=C1C2=CC=CC=C2C=CC3=CC=CC=C13.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02918.html |
| Additional Information | NULL |