Racemic Ezetimibe D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-16398 |
| Alternative Name(s) | (3R,4S)-3-{3-[4-fluoro(2,3,5,6-D4)phenyl]-3-hydroxypropyl}-1-(4-fluorophenyl)-4-(4-hydroxyphenyl)azetidin-2-one |
| Research Area | Labeled Ezetimibe, intended for use as an internal standard for the quantification of Ezetimibe by GC- or LC-mass spectrometry. |
| Molecular Formula | C24H17D4F2NO3 |
| CAS# | NULL |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C1=C([2H])C([2H])=C(F)C([2H])=C1[2H])CC[C@@H]2[C@@H](C3=CC=C(O)C=C3)N(C4=CC=C(F)C=C4)C2=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO16398.html |
| Additional Information | NULL |