4-Methyl-D3-imidazole
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-03531 |
| Alternative Name(s) | 4-Methylimidazole-D3.;4-Methylimidazole-D3. |
| Research Area | Labeled Methylimidazole, intended for use as an internal standard for the quantification of Methylimidazole by GC- or LC-mass spectrometry. |
| Molecular Formula | NULL |
| CAS# | 1219805-95-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | [2H]C([2H])([2H])C1=CN=CN1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO03531.html |
| Additional Information | NULL |