R-Modafinil D10
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06789 |
| Alternative Name(s) | 2-[(R)-bis(²H5)phenylmethanesulfinyl]cetamide |
| Research Area | Labeled Modafinil, intended for use as an internal standard for the quantification of Modafinil by GC- or LC-mass spectrometry. |
| Molecular Formula | C15H5D10NO2S |
| CAS# | 112111-43-0 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[S@](CC(N)=O)C(C(C([2H])=C1[2H])=C(C([2H])=C1[2H])[2H])C(C([2H])=C2[2H])=C(C([2H])=C2[2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06789.html |
| Additional Information | NULL |
