Pioglitazone D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02741 |
| Alternative Name(s) | 5-({4-[2-(5-ethylpyridin-2-yl)(D4)ethoxy]phenyl}methyl)-1,3-thiazolidine-2,4-dione |
| Research Area | Labelled Pioglitazone , which is used as an antidiabetic.;Labeled Pioglitazone, intended for use as an internal standard for the quantification of Pioglitazone by GC- or LC-mass spectrometry. |
| Molecular Formula | C19H16D4N2O3S |
| CAS# | 1134163-29-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N1)C(SC1=O)CC(C([2H])=C2[2H])=C(C([2H])=C2OCCC3=CC=C(CC)C=N3)[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02741.html |
| Additional Information | NULL |