Linoleic Acid 13C18
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-14403 |
| Alternative Name(s) | (9Z,12Z)-(1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18- ��C18)octadeca-9,12-dienoic acid |
| Research Area | Labeled Linoleic Acid, intended for use as an internal standard for the quantification of Linoleic Acid by GC- or LC-mass spectrometry. |
| Molecular Formula | [13C]18H32O2 |
| CAS# | 287111-25-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[13C]([13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2]/[13CH]=[13CH][13CH2]/[13CH]=[13CH][13CH2][13CH2][13CH2][13CH2][13CH3])=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO14403.html |
| Additional Information | NULL |