Quinapril D5
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-14665 |
| Alternative Name(s) | 2-(2-{[1-ethoxy-1-oxo-4-(D5)phenylbutan-2- yl]amino}propanoyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid |
| Research Area | Labeled Quinapril, intended for use as an internal standard for the quantification of Quinapril by GC- or LC-mass spectrometry. |
| Molecular Formula | C25H25D5N2O5 |
| CAS# | 1279029-79-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N(CC1=CC=CC=C1C2)[C@@H]2C(O)=O)[C@H](C)N[C@H](C(OCC)=O)CCC(C([2H])=C3[2H])=C(C([2H])=C3[2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO14665.html |
| Additional Information | NULL |