Biotin D2
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-11977 |
| Alternative Name(s) | 5-[(3aS,4S,6aR)-2-oxo-hexahydro(6,6-D2)-1H- thieno[3,4-d]imidazolidin-4-yl]pentanoic acid |
| Research Area | Labeled Biotin, intended for use as an internal standard for the quantification of Biotin by GC- or LC-mass spectrometry. |
| Molecular Formula | C10H14D2N2O3S |
| CAS# | 1217481-41-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(CCCC[C@H]1[C@](NC2=O)([H])[C@](N2)([H])C([2H])([2H])S1)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11977.html |
| Additional Information | NULL |