O-Desmethyl Venlafaxine D10
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-07055 |
| Alternative Name(s) | Desvenlafaxine D10;4-[2-(dimethylamino)-1-[1-hydroxy(D10)cyclohexyl]ethyl]phenol |
| Research Area | a metabolite of Venlafaxine .;Labeled Venlafaxine, intended for use as an internal standard for the quantification of Venlafaxine by GC- or LC-mass spectrometry. |
| Molecular Formula | C16H15D10NO2 |
| CAS# | 1062607-49-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC1(C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H])C(C2=CC=C(O)C=C2)CN(C)C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO07055.html |
| Additional Information | NULL |