Felodipine EP Impurity B
Impurities
| Trivial name | NULL |
| Catalog Number | CS-T-23465 |
| Alternative Name(s) | Felodipine EP Impurity B;Felodipine 3,5-Dimethyl Ester.;4-(2,3ethyl-3,5-pyridin3,5-Dimethyl Ester;4-(2,3ethyl-3,5-pyridin3,5-Dimethyl Ester;Felodipine 3,5-Dimethyl Ester. |
| Research Area | Dimethyl ester analogue of the calcium channel blockers Felopidine and Nifedipine . |
| Molecular Formula | NULL |
| CAS# | 91189-59-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C(C(C(C=CC=C1Cl)=C1Cl)C(C(OC)=O)=C(C)N2)=C2C)OC |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST23465.html |
| Additional Information | NULL |