Midazolam D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02867 |
| Alternative Name(s) | methyl-2,4,8- triaza]tetradca- 1(14),3,5,8,10,12-hexaene |
| Research Area | Labeled Midazolam, intended for use as an internal standard for the quantification of Midazolam by GC- or LC-mass spectrometry. |
| Molecular Formula | C18H10DClFN3 |
| CAS# | 59467-70-8 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | ClC1=CC=C2N3C(C([2H])([2H])[2H])=NC=C3CN=C(C(C=CC=C4)=C4F)C2=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02867.html |
| Additional Information | NULL |