Lurasidone Hydrochloride D8
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06741 |
| Alternative Name(s) | 4,7-Methano-1H-isoindole-1,3(2H)-dione, 2-((2-((4-(1,2-benzisothiazol-3-yl)-1- piperazinyl D8)methohydrchloride |
| Research Area | Labeled Lurasidone, intended for use as an internal standard for the quantification of Lurasidone by GC- or LC-mass spectrometry. |
| Molecular Formula | C28H29DClN4O2S |
| CAS# | 1132654-54-6 (Freebase) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C([C@@]([H])([C@]1(C2=O)[H])[C@@]3(C[C@]1(CC3)[H])[H])N2C[C@@H]4CCCC[C@H]4CN5C([2H])(C([2H])(N(C([2H])(C5([2H])[2H])[2H])C6=NSC7=CC=CC=C67)[2H])[2H].Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06741.html |
| Additional Information | NULL |