2-Hydroxy Atorvastatin D5 Disodium Salt
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02781 |
| Alternative Name(s) | sodium (3R,5R)-7-(2-(4-fluorophenyl)-5-isopropyl-4-((2-oxidophen1-yl)-3,5-dihydroxyheptanoate |
| Research Area | Labeled Atorvastatin Metabolite.;Labeled Atorvastatin, intended for use as an internal standard for the quantification of Atorvastatin by GC- or LC-mass spectrometry. |
| Molecular Formula | C33H28D5FN2Na2O6 |
| CAS# | 1276537-19-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(NC1=C([O-])C=CC=C1)C2=C(C(C)C)N(CC[C@H](C[C@H](CC([O-])=O)O)O)C(C3=CC=C(C=C3)F)=C2C4=C([2H])C([2H])=C([2H])C([2H])=C4[2H].[Na+].[Na+] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02781.html |
| Additional Information | NULL |
