Nicotinuric Acid D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06812 |
| Alternative Name(s) | 2-[(D4)pyridin-3-ylformamido]acetic acid |
| Research Area | Labeled Nicotinuric Acid, intended for use as an internal standard for the quantification of Nicotinuric Acid by GC- or LC-mass spectrometry. |
| Molecular Formula | C8H4D4N2O3 |
| CAS# | 1216737-36-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C(C([2H])=C1[2H])=C(N=C1[2H])[2H])NCC(O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06812.html |
| Additional Information | NULL |