Chlorpromazine D6 Hydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-03087 |
| Alternative Name(s) | [3-pyl]bis(2H3)methylamine hydrochloride;2-Chloro-N,N-(dimethyl-d6)-10H-phenothiazine-10-propanamine Hydrochloride; 2-Chloro-10-[3-(dimethylamino-d6)propyl]phenothiazine Hydrochloride; Klorproman-d6; Marazine-d6; Norcozine-d6; Torazina-d6; Tranzene-d6; |
| Research Area | Labelled Chlorpromazine . Used as an antiemetic; antipsychotic.;Labeled Chlorpromazine, intended for use as an internal standard for the quantification of Chlorpromazine by GC- or LC-mass spectrometry. |
| Molecular Formula | C17H14D6Cl2N2S |
| CAS# | 1228182-46-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | ClC1=CC=C2C(N(C3=CC=CC=C3S2)CCCN(C([2H])([2H])[2H])C([2H])([2H])[2H])=C1.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO03087.html |
| Additional Information | NULL |