Norgestrel D6
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06823 |
| Alternative Name(s) | Leonorgestrel;(-)-Norgestrel D6 (Leonorgestrel);(17α)-(+/-)-13-Ethyl-17-hydroxy-18,19-dinorpregn-4-en-20-yn-3-one-d6; (+/-)-13-Ethyl-17α-ethynyl-17-hydroxygon-4-en-3-one-d6; (+/-)-Norgestrel-d6; DL-Norgestrel-d6; FH 122A-d6; Methylnorethindrone-d6; Monovar-d6; Neogest-d6; Ovrette-d6; Postinor-d6; SH 70850-d6; SH 850-d6; Wy 3707-d6; |
| Research Area | Labelled (-)-Norgestrel, an emergency contraceptive. Levonorgestrel is safe, tolerated and effective in emergency contraception in woman. Labeled Norgestrel, intended for use as an internal standard for the quantification of Norgestrel by GC- or LC-mass spectrometry. |
| Molecular Formula | C21H22D6O2 |
| CAS# | 6533-00-2 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC[C@@]1([C@]2(O)C#C)[C@](CC2)([H])[C@@](CC([2H])([2H])C3=C([2H])C4=O)([H])[C@]([C@@]3([2H])CC4([2H])[2H])([H])CC1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06823.html |
| Additional Information | NULL |