Cefuroxime D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06475 |
| Alternative Name(s) | (6R,7R)-3-[[(Amuranyl(methoxyiminxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic Acid D3 |
| Research Area | Intended for use as an internal standard for the quantification of Cefuroxime by GC- or LC-mass spectrometry. |
| Molecular Formula | C16H13D3N4O8S |
| CAS# | 1803240-98-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C(N1[C@@]2([H])[C@H](NC(/C(C3=CC=CO3)=NOC([2H])([2H])[2H])=O)C1=O)=C(CS2)COC(N)=O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06475.html |
| Additional Information | NULL |