Eptifibatide
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-00214 |
| Alternative Name(s) | N6-(Aminoiminomethyl)-N2-(3-L-.α.-aspartyl-L-tryptophyl-L-prolyllic (16)-Disulfide; Integrelin; Integrilin; Intrifiban;N6-(aminoiminomethyl)-N2-(3-mercapto-1-oxopropyl)-L-lysylglycyl-L-α-aspartyl-L-tryptophyl-L-prolyl-L-cysteinamide, cyclic (1,6)disulfide |
| Research Area | A Arginin-glycin-aspartat-mimetic, reversibly binds to platelets to reduce the risk of cardiac ischemic events. |
| Molecular Formula | C35H49N11O9S2 |
| CAS# | 188627-80-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N(CCC1)[C@]1([H])C(N[C@@H](CSSCCC2=O)C(N)=O)=O)[C@](NC([C@@H](NC(CNC([C@@H](N2)CCCCNC(N)=N)=O)=O)CC(O)=O)=O)([H])CC3=CNC4=CC=CC=C34 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00214.html |
| Additional Information | NULL |