Doxercalciferol D6
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06565 |
| Alternative Name(s) | (1R,3S,5Z)-5-{2-[(1R,3aS,4E,7aR)-7a-methyl-1-[(2R,3E,5R)-6-(D3)methyl-5-methyl(7,7,7-D3)hept-3-en-2-yl]-octahydro-1H-inden-4-ylidene]ethylidene}-4-methylidenecyclohexane-1,3-diol |
| Research Area | Labeled Calciferol, intended for use as an internal standard for the quantification of Calciferol by GC- or LC-mass spectrometry. |
| Molecular Formula | C28H38D6O2 |
| CAS# | 54573-75-0 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@]([C@@]1([H])[C@H](C)/C=C/[C@H](C)C(C([2H])([2H])[2H])C([2H])([2H])[2H])(CCC/2)[C@](CC1)([H])C2=CC=C(C[C@@H](O)C[C@@H]3O)/C3=C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06565.html |
| Additional Information | NULL |