Anagliptin D7
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-11889 |
| Alternative Name(s) | (S)-N-(2-((2-(2-cyano-2,3,3,4,4,5,5-heptamethylpyrrolidin-1-yl)-2-oxoethyl)amino)-2-methylpropyl)-2-methylpyrazolo[1,5-a]pyrimidine-6-carboxamide D7. |
| Research Area | Labeled Anagliptin, intended for use as an internal standard for the quantification of Anagliptin by GC- or LC-mass spectrometry. |
| Molecular Formula | C19H18D7N7O2 |
| CAS# | 739366-20-2 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C(C=N1)=CN2C1=CC(C)=N2)NCC(C)(C)NCC(N(C([2H])([2H])C([2H])([2H])C3([2H])[2H])[C@]3([2H])C#N)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11889.html |
| Additional Information | NULL |