Dinoprostone EP Impurity C
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-11875 |
| Alternative Name(s) | (E)-7-((1R,2R,3R)-3-hydroxy-2-((S,E)-3-hydroxyoct-1-en-1-yl)-5-oxocyclopentyl)hept-5-enoic acid; 5,6-trans-PGE2; 5-trans-PGE2; 5-trans-Prostaglandin E2; trans-Dinoprostone; (5E,11α,13E,15S)-11,15-Dihydroxy-9-oxoprosta-5,13-dien-1-oic Acid; |
| Research Area | Impurity in commercial preparation of Dinoprostone. 5-trans-Prostaglandin E2 is used as a substance for the isolation of new naturally occuring prostaglandin 5-trans-PGA2, in the synthesis of 5-trans-PGE2, 5-trans-PGF2a and their 5,6-trans isomers. |
| Molecular Formula | C20H32O5 |
| CAS# | 36150-00-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1[C@@H]([C@H]([C@H](O)C1)/C=C/[C@@H](O)CCCCC)C/C=C/CCCC(O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11875.html |
| Additional Information | NULL |
