Caspofungin Acetate
Intermediates
| Trivial name | NULL |
| Catalog Number | CS-T-50400 |
| Alternative Name(s) | NULL |
| Research Area | An echinocandin that inhibits the synthesis of ß (1,3)-D-glucan, an integral component of the fungal cell wall. An antifungal drug used in the treatment of invasive fungal infections. |
| Molecular Formula | C56H96N10O19 |
| CAS# | 179463-17-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(O)=O.O=C([C@](NC(C(NC([C@@](C[C@@H](O)C1)([H])N1C2=O)=O)[C@H](O)[C@H](C3=CC=C(O)C=C3)O)=O)([H])[C@H](O)CCN)N(CC[C@@H]4O)[C@]4([H])C(N[C@H]([C@@H](C[C@@H](C(NC2[C@H](O)C)=O)NC(CCCCCCCC[C@@H](C)C[C@@H](C)CC)=O)O)NCCN)=O.CC(O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST50400.html |
| Additional Information | NULL |