4-Epianhydrotetracycline Hydrochloride
Impurities
| Trivial name | NULL |
| Catalog Number | CS-T-21689 |
| Alternative Name(s) | 4-Epianhydrotetracycline Hydrochloride;Tetracycline hydrochloride IMP D;(4R,4aS,12aS)-4-(Dimethylamino)-1,4,4a,5,12,12a-hexahydro-3,10,11,12a-tetrahydroxy-6-methyl-1,12-dioxo-2-naphHydrochloride;4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dio |
| Research Area | An antibiotic derived from Tetracycline. Studies have shown that this derivative can have a 250-fold higher toxicity depending on the system under study. |
| Molecular Formula | C22H23ClN2O7 |
| CAS# | 4465-65-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@](C1=O)(C(C(C(N)=O)=C2O)=O)[C@](CC3=C1C(O)=C(C(O)=CC=C4)C4=C3C)([H])[C@H]2N(C)C.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST21689.html |
| Additional Information | NULL |
