Ascorbic acid 13C6
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-10050 |
| Alternative Name(s) | (5R)-5-[(1S)-1,2-dihydroxy(1,2-13C2)ethyl]-3,4- dihydroxy-2,5-dihydro(2,3,4,5-13C4)furan-2-one |
| Research Area | Labeled Ascorbic acid, intended for use as an internal standard for the quantification of Ascorbic acid by GC- or LC-mass spectrometry. |
| Molecular Formula | [1C]6H8O6 |
| CAS# | 1354064-87-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[13C@H]([13C@](O1)([H])[13C](O)=[13C](O)[13C]1=O)[13CH2]O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10050.html |
| Additional Information | NULL |