2-Amino-ethan-1,1,2,2-D4-ol
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-20024 |
| Alternative Name(s) | 2-amino(D4)ethan-1-ol; Ethanol-1,1,2,2-d4-amine; 1-Amino-2-hydroxyethane-d4; 2-Amino-1-ethanol-d4; 2-Aminoethanol-d4; 2-Aminoethyl alcohol-d4; 2-Ethanolamine-d4; 2-Hydroxyethanamine-d4; 2-Hydroxyethylamine-d4; Aminoethanol-d4; Colamine-d4 |
| Research Area | 2-Amino-ethan-1,1,2,2-d4-ol is labelled Ethanolamine which is used in the preparation of various pharmaceutical compounds and inhibitors. Substituted carboxamides are synthesized using Ethanolamine that show potent antitumor activity. |
| Molecular Formula | NULL |
| CAS# | 85047-08-01 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NC([2H])([2H])C([2H])([2H])O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO20024.html |
| Additional Information | NULL |