Misoprostol Acid D5
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-03191 |
| Alternative Name(s) | Misoprostol acid D5;(11a,13E)-11,16-Dihydroxy-16-methyl-9-oxo-prost-13-en-1id; (+/-)-15-Deoxy-(16RS)-16-hydroxy |
| Research Area | A labelled metabolite of Misoprostol. Cytoprotective PGE1 analog that prevents NSAID-induced gastric ulceration.;Labeled Misoprostol acid, intended for use as an internal standard for the quantification of Misoprostol acid by GC- or LC-mass spectrometry. |
| Molecular Formula | C21H31D5O5 |
| CAS# | 1337917-44-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1[C@@H]([C@H]([C@H](O)C1)/C=C/CC(C([2H])([2H])[2H])(O)C([2H])([2H])CCC)CCCCCCC(O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO03191.html |
| Additional Information | NULL |