Cefixime 13C 15N2
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02881 |
| Alternative Name(s) | (6R,7R)-7-[[(2Z)-2-(2-Amino-4-thiazolyl-13C,15N2)-2-[(carboxymethoxy)imino]acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic Acid; FK-027-13C,15N2; FR- 17027-13C,15N2; CL-284635-13C,15N2;Cefixoral-13C,15N2; |
| Research Area | Labelled Cefixime . Orally active, third generation cephalosporin antibiotic.;Labeled Cefixime, intended for use as an internal standard for the quantification of Cefixime by GC- or LC-mass spectrometry. |
| Molecular Formula | C15[13C]H15N3[15N]2O7S2 |
| CAS# | 79350-37-1 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C(N1[C@@]2([H])[C@H](NC(/C(C3=CS[13C]([15NH2])=[15N]3)=NOCC(O)=O)=O)C1=O)=C(CS2)C=C)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02881.html |
| Additional Information | NULL |
