Octreotide Acetate D8
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-03500 |
| Alternative Name(s) | (4R,7R,10R,13S,16R,19S)‐19‐[2‐amino‐3‐ (D5)phenyl(D3)propanamido]‐10‐(4‐aminobutyl)‐16‐ benzyl‐N‐[(2S,3S)‐1,3‐dihydroxybutan‐2‐yl]‐7‐[(1R)‐1‐ hydroxyethyl]‐13‐(1H‐indol‐3‐ylmethyl)‐ 6,9,12,15,18‐pentaoxo‐1,2‐dithia‐5,8,11,14,17‐ pentaamide acetate. |
| Research Area | Labeled Octreotide, intended for use as an internal standard for the quantification of Octreotide by GC- or LC-mass spectrometry. |
| Molecular Formula | NULL |
| CAS# | 1240797-41-4 free base |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N[C@@](C(N[C@@]1([H])[C@H](O)C)=O)([H])CCCCN)[C@@H](NC([C@@H](NC([C@](CSSC[C@@H](C(NC(CO)C(O)C)=O)NC1=O)([H])NC(C(N)([2H])C([2H])([2H])C(C([2H])=C2[2H])=C(C([2H])=C2[2H])[2H])=O)=O)CC3=CC=CC=C3)=O)CC4=CNC5=CC=CC=C45.CC([O-])=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO03500.html |
| Additional Information | NULL |