Crisaborole D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-16638 |
| Alternative Name(s) | 4-[(1-hydroxy-1,3-dihydro-2,1-benzoxaborol-5-yl)oxy](D4)benzonitrile |
| Research Area | Labeled Crisaborole, intended for use as an internal standard for the quantification of Crisaborole by GC- or LC-mass spectrometry. |
| Molecular Formula | C14H6D4BNO3 |
| CAS# | 906673-24-3 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | [2H]C1=C([2H])C(C#N)=C([2H])C([2H])=C1OC1=CC=C2B(O)OCC2=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO16638.html |
| Additional Information | NULL |