Vincamine 13CD3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-CX-00633 |
| Alternative Name(s) | (41S,12S,13aS)-tert-butyl (13C D3) 13a-ethyl-12-hydroxy-2,3,41,5,6,12,13,13a-octahydro-1H-indolo[3,2,1-de]pyrido[3,2,1-ij][1,5]naphthyridine-12-carboxylate |
| Research Area | Labeled Vincamine, intended for use as an internal standard for the quantification of Vincamine by GC- or LC-mass spectrometry. |
| Molecular Formula | C20[13C]H23D3N2O3 |
| CAS# | 1617-90-9 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C([C@](N1C2=C3C4=CC=CC=C14)(C[C@](CC)(CCC5)[C@]2([H])N5CC3)O)O[13C]([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSCX00633.html |
| Additional Information | NULL |