Sacubitril D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-15672 |
| Alternative Name(s) | 3‐{[(2S,4R)‐5‐ethoxy‐4‐methyl‐5‐oxo‐1‐(4‐phenylphenyl)pentan‐2‐yl]carbamoyl}(D4)propanoic acid |
| Research Area | Labeled Sacubitril, intended for use as an internal standard for the quantification of Sacubitril by GC- or LC-mass spectrometry. |
| Molecular Formula | C24H25D4NO5 |
| CAS# | 1884269-07-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@H](C(OCC)=O)C[C@H](NC(C([2H])([2H])C([2H])([2H])C(O)=O)=O)CC1=CC=C(C2=CC=CC=C2)C=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO15672.html |
| Additional Information | NULL |