Vildagliptin D7
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-16022 |
| Alternative Name(s) | (2S)‐1‐{2‐[(3‐hydroxyadamantan‐1‐yl)amino]acetyl}(D7)pyrrolidine‐2‐carbonitrile |
| Research Area | Labeled Vildagliptin, intended for use as an internal standard for the quantification of Vildagliptin by GC- or LC-mass spectrometry. |
| Molecular Formula | C17H18D7N3O2 |
| CAS# | 1133208-42-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N(C([2H])([2H])C([2H])([2H])C1([2H])[2H])[C@]1([2H])C#N)CN[C@](C[C@H](C2)C3)(C[C@@H]2C4)C[C@]34O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO16022.html |
| Additional Information | NULL |