Frovatriptan D3 Hydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06637 |
| Alternative Name(s) | (3R)-3-[(H3)methylamino]-2,3,4,9-tetrahydro-ride |
| Research Area | Labeled Frovatriptan, intended for use as an internal standard for the quantification of Frovatriptan by GC- or LC-mass spectrometry. |
| Molecular Formula | C14H15DClN3O |
| CAS# | 1129545-77-2 (Free base) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NC(C1=CC=C2C(C(C[C@H](NC([2H])([2H])[2H])CC3)=C3N2)=C1)=O.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06637.html |
| Additional Information | NULL |