Carvedilol D5
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06468 |
| Alternative Name(s) | NULL |
| Research Area | Labeled Carvedilol, intended for use as an internal standard for the quantification of Carvedilol by GC- or LC-mass spectrometry. |
| Molecular Formula | NULL |
| CAS# | 929106-58-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C([2H])([2H])NCCOC(C=CC=C1)=C1OC)([2H])C([2H])([2H])OC2=C3C4=CC=CC=C4NC3=CC=C2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06468.html |
| Additional Information | NULL |