Diphenhydramine D5 Hydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06550 |
| Alternative Name(s) | dimethyl({2-[(D5)phenyl(phenyl)methoxy]ethyl})amine hydrochloride |
| Research Area | Labeled Diphenhydramine, intended for use as an internal standard for the quantification of Diphenhydramine by GC- or LC-mass spectrometry. |
| Molecular Formula | C17H17D5ClNO |
| CAS# | 1219795-16-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CN(C)CCOC(C1=CC=CC=C1)C(C([2H])=C2[2H])=C(C([2H])=C2[2H])[2H].Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06550.html |
| Additional Information | NULL |