Pazopanib 13C D3 Hydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06855 |
| Alternative Name(s) | NULL |
| Research Area | Labeled Pazopanib, intended for use as an internal standard for the quantification of Pazopanib by GC- or LC-mass spectrometry. |
| Molecular Formula | C2013CH21D3ClN7O2S |
| CAS# | 1261398-44-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC1=C(C=CC(N(C2=NC(NC3=CC([S](N)(=O)=O)=C(C)C=C3)=NC=C2)[13C]([2H])([2H])[2H])=C4)C4=NN1C.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06855.html |
| Additional Information | NULL |