Dexmedetomidine Hydrochloride
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-01369 |
| Alternative Name(s) | 4-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1H-imidazole hydrochloride |
| Research Area | Dexmedetomidine hydrochloride is the active isomer of medetomide which acts a potent, highly selective a2-AR (a2-adrenoceptor) agonist. |
| Molecular Formula | C13H17ClN2 |
| CAS# | 145108-58-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@H](C1=CN=CN1)C(C=CC=C2C)=C2C.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01369.html |
| Additional Information | NULL |