tert-Butyl Dicarbonate
Fine Chemicals
| Trivial name | NULL |
| Catalog Number | CS-T-50040 |
| Alternative Name(s) | di-tert-butyldicarbonate |
| Research Area | Reagent commonly used in organic chemistry for the introduction of the BOC protecting group. |
| Molecular Formula | C10H18O5 |
| CAS# | 24424-99-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(C)(OC(OC(OC(C)(C)C)=O)=O)C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST50040.html |
| Additional Information | NULL |