Carbocisteine Lactam Sodium Salt
Amino Acids and Derivatives
| Trivial name | NULL |
| Catalog Number | CS-T-10463 |
| Alternative Name(s) | sodium(3R)-5-oxothiomorpholine-3-carboxylate |
| Research Area | Carbocisteine Lactam is an impurity of the mucolytic agent Carbocisteine . |
| Molecular Formula | NULL |
| CAS# | 88933-48-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC([C@H](CSC1)NC1=O)=O.[NaH] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST10463.html |
| Additional Information | NULL |