D-Mannitol D8
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-11013 |
| Alternative Name(s) | (2R,3R)-(D8)hexane-1,2,3,4,5,6-hexol |
| Research Area | Labeled Mannitol, intended for use as an internal standard for the quantification of Mannitol by GC- or LC-mass spectrometry. |
| Molecular Formula | C6H6D8O6 |
| CAS# | 69-65-8 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@]([C@@]([C@@](C(O)([2H])[2H])(O)[2H])(O)[2H])([C@@](C(O)([2H])[2H])(O)[2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11013.html |
| Additional Information | NULL |