Saxagliptin
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-30766 |
| Alternative Name(s) | Saxagliptin; Onglyza ; (1S,3S,5S)-2-[(2S)-2-Amino-2-(3-hydroxytricyclo[3.3.1.13,7]dec-1-yl)acetyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile; BMS 477118; BMS 477118-11; |
| Research Area | Saxagliptin is used as monotherapy or in combination with other drugs for the treatment of Type 2 diabetes. |
| Molecular Formula | C18H25N3O2 |
| CAS# | 361442-04-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | N[C@@H]([C@](C[C@H](C1)C2)(C[C@@H]1C3)C[C@]23O)C(N([C@@H](C4)C#N)[C@@H]5[C@H]4C5)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30766.html |
| Additional Information | NULL |