Calcipotriol
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-06254 |
| Alternative Name(s) | clopropyl-9,109),22-tetraene-1α,3β,24-triol; Calcipotriol (Anhydrous). |
| Research Area | Calcipotriol is a topical dermatologic for the treatment of moderate plaque psoriasis. |
| Molecular Formula | C27H40O3 |
| CAS# | 112965-21-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@]([C@@]1([H])[C@H](C)/C=C/[C@H](C2CC2)O)(CCC/3)[C@](CC1)([H])C3=CC=C(C[C@@H](O)C[C@@H]4O)/C4=C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06254.html |
| Additional Information | NULL |