Promethazine D6 Hydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06888 |
| Alternative Name(s) | bis(H3)methyl[1-(10H-phenothiazin-10-yl)propan-2-yl]amine hydrochloride |
| Research Area | Labeled Promethazine, intended for use as an internal standard for the quantification of Promethazine by GC- or LC-mass spectrometry. |
| Molecular Formula | C17H15D6ClN2S |
| CAS# | 1189947-02-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(N(C([2H])([2H])[2H])C([2H])([2H])[2H])CN1C2=CC=CC=C2SC3=CC=CC=C13.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06888.html |
| Additional Information | NULL |