20-β-Dihydroprogesterone
Impurities
| Trivial name | NULL |
| Catalog Number | CS-T-18985 |
| Alternative Name(s) | (20R)-20-Hydroxy-pregn-4-en-3-one;(8R,9S,10S,13S,14S,17S)-17-acetyl-10,13-dimethyltetradecahydro-1H-cyclopenta[a]phenanthren-3(2H)-one |
| Research Area | 20-Beta-Dihydroprogesterone is an impurity of Progesterone , a steroid hormone secreted by the corpus luteum. Progesterone have various significant physiological roles, such as inducing the maturation and secretory activities of the uterine endothelium and the suppression of ovulation. Progesterone is also implicated in the etiology of breast cancer. ;Impurity in commercial preparations of Progesterone |
| Molecular Formula | C21H32O2 |
| CAS# | 145-15-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@](C(CC1)=CC2=O)(CC2)[C@]3([H])[C@]1([H])[C@@](CC[C@]4([H])[C@H](O)C)([H])[C@]4(C)CC3 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST18985.html |
| Additional Information | NULL |