Leflunomide D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-11466 |
| Alternative Name(s) | Leflunomidum-d4;Leflunomida-d4;5-Methylisoxazole-4-[4-trifluoromettrifluoromethyl)phenyl]-4-isoxazolecarboxamide-d4. |
| Research Area | Labeled Leflunomide, intended for use as an internal standard for the quantification of Leflunomide by GC- or LC-mass spectrometry. |
| Molecular Formula | C12H5D4F3N2O2 |
| CAS# | 1189987-23-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C(C=NO1)=C1C)NC(C([2H])=C2[2H])=C(C([2H])=C2C(F)(F)F)[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11466.html |
| Additional Information | NULL |