20 β-hydroxymethyl Prednisolone
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-16489 |
| Alternative Name(s) | (6S,8S,9S,10R,11S,13S,14S,17R)-17-((S)-1,2-dihydroxyethyl)-11,17-dihydroxy-6,10,13-trimethyl-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-3-one |
| Research Area | Labeled Prednisolone, intended for use as an internal standard for the quantification of Prednisolone by GC- or LC-mass spectrometry. |
| Molecular Formula | C22H32O5 |
| CAS# | 387-66-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@]1([C@@]2(O)[C@@H](O)CO)[C@](CC2)([H])[C@@](C[C@H](C)C3=CC4=O)([H])[C@]([C@]3(C=C4)C)([H])[C@@H](O)C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO16489.html |
| Additional Information | NULL |